CymitQuimica logo

CAS 5724-80-1

:

5-oxo-5-pyrrolidin-1-ylpentanoate

Description:
5-Oxo-5-pyrrolidin-1-ylpentanoate, with the CAS number 5724-80-1, is an organic compound characterized by its ester functional group and a pyrrolidine ring. This substance typically exhibits a moderate polarity due to the presence of both the ester and the nitrogen-containing pyrrolidine moiety. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The compound may have applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals, due to the presence of the pyrrolidine structure, which is often found in biologically active molecules. Its solubility in organic solvents suggests it can be utilized in various chemical reactions and formulations. Additionally, the presence of the oxo group indicates potential reactivity, making it a candidate for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14NO3
InChI:InChI=1/C9H15NO3/c11-8(4-3-5-9(12)13)10-6-1-2-7-10/h1-7H2,(H,12,13)/p-1
InChI key:WFRISUAVYJAVNH-UHFFFAOYSA-N
SMILES:C1CCN(C1)C(=O)CCCC(=O)[O-]
Found 4 products.