CAS 573-40-0
:Rapanone
Description:
Rapanone, with the CAS number 573-40-0, is a chemical compound that belongs to the class of natural products known as flavonoids. It is primarily derived from certain plant sources and is characterized by its unique chemical structure, which typically includes a flavone backbone. Rapanone exhibits various biological activities, including antioxidant properties, which can contribute to its potential health benefits. It is often studied for its effects on cellular processes and its role in traditional medicine. The compound is generally soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many natural compounds, rapanone's specific applications and effects can vary based on its concentration and the context of its use, making it a subject of interest in both pharmacological and biochemical research.
Formula:C19H30O4
InChI:InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3
InChI key:InChIKey=AMKNOBHCKRZHIO-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCC)C=1C(=O)C(O)=CC(=O)C1O
Synonyms:- 2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy-3-tridecyl-
- 2,5-Dihydroxy-3-tridecyl-1,4-benzoquinone
- 2,5-Dihydroxy-3-tridecyl-2,5-cyclohexadiene-1,4-dione
- NSC 340285
- Rapanone
- Ropanone
- p-Benzoquinone, 2,5-dihydroxy-3-tridecyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Rapanone
CAS:Rapanone (2,5-Dihydroxy-3-tridecyl-[1,4]benzoquinone) is a natural benzoquinone that is a potent and selective inhibitor of human synovial PLA2.Formula:C19H30O4Purity:99.56%Color and Shape:SolidMolecular weight:322.44Rapanone
CAS:Rapanone is a bioactive compound classified as a quinone, which is isolated from the Annona species, particularly from the plant family Annonaceae. This compound is known for its interaction with cellular respiration mechanisms, where it specifically acts as an inhibitor of mitochondrial NADH-ubiquinone oxidoreductase, also known as complex I of the electron transport chain. The inhibition of complex I interferes with ATP production by disrupting the proton gradient required for ATP synthesis, leading to a depletion of energy within the cell.Formula:C19H30O4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:322.44 g/mol






