
CAS 5743-12-4
:1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-, hydrate (1:1)
Description:
1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-, hydrate (1:1), commonly known as caffeine, is a naturally occurring stimulant found in various plants. It is classified as a purine alkaloid and has a molecular formula that reflects its complex structure, which includes a fused bicyclic ring system. Caffeine is known for its psychoactive properties, primarily acting as a central nervous system stimulant, which can enhance alertness and reduce fatigue. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. Caffeine is soluble in water and organic solvents, making it versatile for various applications, including food and beverage industries, pharmaceuticals, and cosmetics. Its pharmacological effects are attributed to its ability to block adenosine receptors, leading to increased neuronal firing and the release of neurotransmitters. Additionally, caffeine has been studied for its potential health benefits and risks, including its role in metabolism and cardiovascular health.
Formula:C8H10N4O2·H2O
InChI:InChI=1S/C8H10N4O2.H2O/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3;1H2
InChI key:InChIKey=LCHGOKZNRDAXEK-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(C)C(=O)N1C)N=CN2C.O
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-, monohydrate
- Caffeine, monohydrate
- 1H-Purine-2,6-dione, 3,7-dihydro-1,3,7-trimethyl-, hydrate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
CAFFEINE M.P. RS
CAS:CAFFEINE M.P. RSFormula:C8H10N4O2Color and Shape:PowderMolecular weight:194.1906


