CymitQuimica logo

CAS 57478-19-0

:

4-(4-Trifluoromethylphenoxy)aniline

Description:
4-(4-Trifluoromethylphenoxy)aniline, with the CAS number 57478-19-0, is an organic compound characterized by its aromatic structure, which includes an aniline moiety and a trifluoromethylphenoxy group. This compound typically exhibits a solid state at room temperature and is known for its distinctive trifluoromethyl group, which enhances its lipophilicity and can influence its reactivity and biological activity. The presence of the aniline group suggests potential applications in dye synthesis, pharmaceuticals, or as an intermediate in organic synthesis. Additionally, the trifluoromethyl group can impart unique electronic properties, making it valuable in materials science and medicinal chemistry. The compound is likely to be moderately soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the trifluoromethyl group. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit varying degrees of toxicity and environmental impact. Overall, 4-(4-Trifluoromethylphenoxy)aniline is a compound of interest in various chemical research fields.
Formula:C13H10F3NO
InChI:InChI=1/C13H10F3NO/c14-13(15,16)9-1-5-11(6-2-9)18-12-7-3-10(17)4-8-12/h1-8H,17H2
InChI key:SMLYUHJGJWSUEC-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(F)(F)F)Oc1ccc(cc1)N
Synonyms:
  • 4-[4-(Trifluoromethyl)phenoxy]aniline
Found 5 products.