CAS 57493-24-0
:4-(3-nitrophenyl)-1,3-thiazol-2-amine
Description:
4-(3-Nitrophenyl)-1,3-thiazol-2-amine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features a nitrophenyl group, which contributes to its potential reactivity and biological activity. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. This compound may also possess biological activity, potentially serving as a lead compound in medicinal chemistry for the development of pharmaceuticals. Its structure allows for various functionalizations, which can be explored for applications in agrochemicals or dyes. Safety data should be consulted for handling, as nitro compounds can be hazardous. Overall, 4-(3-nitrophenyl)-1,3-thiazol-2-amine is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C9H7N3O2S
InChI:InChI=1/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11)
SMILES:c1cc(cc(c1)N(=O)=O)c1csc(=N)[nH]1
Synonyms:- 2-Thiazolamine, 4-(3-nitrophenyl)-
- 4-(3-Nitrophenyl)-1,3-thiazol-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(3-Nitrophenyl)thiazol-2-amine
CAS:Formula:C9H7N3O2SPurity:97%Color and Shape:SolidMolecular weight:221.23582-Amino-4-(3-nitrophenyl)-1,3-thiazole
CAS:2-Amino-4-(3-nitrophenyl)-1,3-thiazolePurity:96%Molecular weight:221.24g/mol2-Amino-4-(3-nitrophenyl)thiazole
CAS:Formula:C9H7N3O2SPurity:>98.0%(GC)(T)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:221.234-(3-Nitrophenyl)thiazol-2-ylamine
CAS:Formula:C9H7N3O2SPurity:97%Color and Shape:SolidMolecular weight:221.234-(3-Nitrophenyl)-1,3-thiazol-2-amine
CAS:4-(3-Nitrophenyl)-1,3-thiazol-2-amine is a spectroscopically active compound that has been reported to have a melting point of about 190°C. It has an absorption maximum of 208 nm and is soluble in acetone, benzene, chloroform, ether, methanol, and water. The yield for the reaction was determined to be about 63%. The chemical structure consists of a thiazole ring with two nitro groups on the phenyl ring. 4-(3-Nitrophenyl)-1,3-thiazol-2-amine has also been shown to react with amines to form oxychlorides. Citric acid can also be used as a reagent for this process.Formula:C9H7N3O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:221.24 g/mol




