CymitQuimica logo

CAS 57493-24-0

:

4-(3-nitrophenyl)-1,3-thiazol-2-amine

Description:
4-(3-Nitrophenyl)-1,3-thiazol-2-amine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features a nitrophenyl group, which contributes to its potential reactivity and biological activity. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and reductions. This compound may also possess biological activity, potentially serving as a lead compound in medicinal chemistry for the development of pharmaceuticals. Its structure allows for various functionalizations, which can be explored for applications in agrochemicals or dyes. Safety data should be consulted for handling, as nitro compounds can be hazardous. Overall, 4-(3-nitrophenyl)-1,3-thiazol-2-amine is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C9H7N3O2S
InChI:InChI=1/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11)
InChI key:CHBDOPARQRNCDM-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N(=O)=O)c1csc(=N)[nH]1
Synonyms:
  • 2-Thiazolamine, 4-(3-nitrophenyl)-
  • 4-(3-Nitrophenyl)-1,3-thiazol-2-amine
Found 6 products.