CymitQuimica logo

CAS 57575-96-9

:

1H-imidazol-2-amine hydrochloride

Description:
1H-imidazol-2-amine hydrochloride, with the CAS number 57575-96-9, is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water, making it suitable for various applications in biological and chemical research. As an amine derivative, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which enhances its stability and solubility in aqueous solutions. 1H-imidazol-2-amine hydrochloride is often utilized in medicinal chemistry and biochemistry, particularly in the synthesis of pharmaceuticals and as a building block for more complex molecules. Its biological activity may include interactions with enzymes or receptors, making it of interest in drug development and therapeutic applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C3H6ClN3
InChI:InChI=1/C3H5N3.ClH/c4-3-5-1-2-6-3;/h1-2H,(H3,4,5,6);1H
InChI key:QKUZBZFCWCJPFK-UHFFFAOYSA-N
SMILES:c1c[nH]c(=N)[nH]1.Cl
Found 3 products.