CAS 576-37-4

DL-Glucuronic acid

Description:

DL-Glucuronic acid is a naturally occurring uronic acid, which is a derivative of glucose. It is characterized by its carboxylic acid functional group, which imparts acidic properties, and its hydroxyl groups, which contribute to its solubility in water. This compound plays a crucial role in the detoxification processes in the body, as it is involved in the conjugation of various substances, facilitating their excretion. DL-Glucuronic acid is typically found in the form of a white crystalline powder and is hygroscopic, meaning it can absorb moisture from the environment. It has a relatively high melting point and is stable under normal conditions, although it can decompose when exposed to strong acids or bases. In addition to its biological significance, DL-Glucuronic acid is utilized in various industrial applications, including pharmaceuticals and cosmetics, due to its ability to enhance the solubility and bioavailability of certain compounds. Its CAS number, 576-37-4, is used for identification in chemical databases and regulatory contexts.

Formula: C₆H₁₀O₇

InChI: InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4-,5-/s2

InChI key: InChIKey=IAJILQKETJEXLJ-ZZVINVELNA-N

SMILES: [C@H]([C@@H]([C@H](C=O)O)O)([C@@H](C(O)=O)O)O

Synonyms:

• Glucuronic acid
• DL-Glucuronic acid

Glucuronic Acid

Controlled Product

CAS: 576-37-4

Formula: C₆H₁₀O₇

Color and Shape: Neat

Molecular weight: 194.14

Ref: TR-G417410

Glucuronic acid

CAS: 576-37-4

Glucuronic acid is a naturally occurring sugar that plays a critical role in the body's detoxification process. It is used in the formation of glucuronides, which are conjugated compounds that aid in the elimination of toxins and other harmful substances from the body. Glucuronic acid has been found to have anticancer properties, as it induces apoptosis (programmed cell death) in cancer cells. It also inhibits protein kinase activity, which is involved in regulating cell growth and division. Chinese medicinal herbs containing glucuronic acid analogs have been used traditionally to treat various types of tumors. Additionally, glucuronic acid has been shown to be an inhibitor of the cell cycle, making it a potential target for cancer therapy. This compound can be found in urine and is often used as a biomarker for various diseases and conditions.

Formula: C₆H₁₀O₇

Purity: Min. 95%

Molecular weight: 194.14 g/mol

Ref: 3D-AAA57637

Glucuronic Acid

CAS: 576-37-4

Formula: C₆H₁₀O₇

Molecular weight: 194.14

Ref: ST-EA-CP-G22001