CAS 5766-67-6
:2,2′,2′′,2′′′-(1,2-Ethanediyldinitrilo)tetrakis[acetonitrile]
Description:
2,2′,2′′,2′′′-(1,2-Ethanediyldinitrilo)tetrakis[acetonitrile], with the CAS number 5766-67-6, is a coordination compound that features a central nitrogen-containing framework. This compound is characterized by its tetrakis structure, where four acetonitrile (CH₃CN) ligands are coordinated to a central nitrogen atom, which is linked to two additional nitrogen atoms through an ethanediyl (ethylene) bridge. The presence of multiple nitrile groups contributes to its potential as a ligand in coordination chemistry, allowing it to form complexes with various metal ions. The acetonitrile ligands enhance solubility in polar organic solvents and can influence the electronic properties of the metal center. This compound may exhibit interesting properties such as stability, solubility, and reactivity, making it relevant in fields such as catalysis, materials science, and coordination chemistry. Its unique structure and functional groups can also lead to specific interactions in biological systems or applications in sensor technology.
Formula:C10H12N6
InChI:InChI=1S/C10H12N6/c11-1-5-15(6-2-12)9-10-16(7-3-13)8-4-14/h5-10H2
InChI key:InChIKey=FDWRKVKXYZRYOD-UHFFFAOYSA-N
SMILES:N(CCN(CC#N)CC#N)(CC#N)CC#N
Synonyms:- (Ethylenedinitrilo)tetraacetonitrile
- 2,2',2'',2'''-(Ethane-1,2-Diyldinitrilo)Tetraacetonitrile
- 2,2′,2′′,2′′′-(1,2-Ethanediyldinitrilo)tetrakis[acetonitrile]
- Acetonitrile, (ethylenedinitrilo)tetra-
- Acetonitrile, 2,2',2'',2'''-(1,2-ethanediyldinitrilo)tetrakis-
- Acetonitrile, 2,2′,2′′,2′′′-(1,2-ethanediyldinitrilo)tetrakis-
- Ai3-23663
- Brn 1711285
- N,N,N',N'-Tetracyanomethylaethylenediamin
- N,N,N',N'-Tetracyanomethylaethylenediamin [German]
- N,N,N',N'-Tetracyanomethylethylenediamine
- Nsc 49104
- Ethylenediaminetetraacetonitrile
- EDTN
- Ethylenediaminetetraacetonitrile
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Ethylenedinitrilo)tetraacetonitrile
CAS:Formula:C10H12N6Color and Shape:SolidMolecular weight:216.248
