CymitQuimica logo

CAS 57712-57-9

:

1-ethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

Description:
1-Ethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, with the CAS number 57712-57-9, is a heterocyclic organic compound that features a pyrimidine ring structure. This compound is characterized by the presence of two carbonyl (dioxo) groups and a cyano (carbonitrile) functional group, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The ethyl group attached to the nitrogen atom enhances its lipophilicity, potentially influencing its biological activity. The compound may exhibit various properties such as solubility in polar solvents, and its stability can be affected by environmental conditions like pH and temperature. Due to its structural features, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds of this class are often investigated for their pharmacological properties, making them of interest in drug development. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C7H7N3O2
InChI:InChI=1/C7H7N3O2/c1-2-10-4-5(3-8)6(11)9-7(10)12/h4H,2H2,1H3,(H,9,11,12)
InChI key:NXKKERVRGXKVFU-UHFFFAOYSA-N
SMILES:CCn1cc(C#N)c(nc1=O)O
Found 3 products.