CAS 57718-07-7
:Ethyl itaconate
Description:
Ethyl itaconate is an organic compound classified as an unsaturated dicarboxylic acid ester. It is derived from itaconic acid and is characterized by its ethyl ester functional group. Ethyl itaconate typically appears as a colorless to pale yellow liquid with a fruity odor. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The compound is known for its reactivity, particularly in polymer chemistry, where it can participate in various polymerization reactions, making it useful as a monomer in the synthesis of biodegradable polymers and copolymers. Ethyl itaconate exhibits properties such as good thermal stability and the ability to form cross-linked structures, which enhances the mechanical properties of the resulting materials. Additionally, itaconate derivatives have been studied for their potential applications in drug delivery systems and as intermediates in organic synthesis. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed due to its potential irritant properties.
Formula:C7H10O4
InChI:InChI=1/C7H10O4/c1-3-11-6(8)4-5(2)7(9)10/h2-4H2,1H3,(H,9,10)
SMILES:CCOC(=O)CC(=C)C(=O)O
Synonyms:- 4-Ethoxy-2-Methylidene-4-Oxobutanoic Acid
- Ethyl itaconate, min. 95 %
- DIETHYL ITACONATE
- 4-Ethoxy-2-methylene-4-oxobutanoic acid
- 3-Monoethyl 1-propene-2,3-dicarboxylate
- 3-Methylenesuccinic acid hydrogen 1-ethyl ester
- Itaconic Acid Monoethyl Ester
- Itaconic acid 4-ethyl ester
- beta-Ethyl Itaconate
- 4-Ethyl Methylenesuccinate
- 4-Ethoxy-2-methylene-4-oxobutyric acid
- 4-Ethyl 2-methylenesuccinate, 4-Ethoxy-2-methylene-4-oxobutyric acid, 4-Ethoxy-2-methylidene-4-oxobutanoic acid
- 2-Methylenesuccinic acid 4-ethyl ester
- Itaconic acid hydrogen 4-ethyl ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Monoethyl Itaconate
CAS:Formula:C7H10O4Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:158.15Butanedioic acid, methylene-, 4-ethyl ester
CAS:Formula:C7H10O4Purity:95%Color and Shape:SolidMolecular weight:158.1519Monoethyl itaconate
CAS:4-Ethoxy-2-methylene-4-oxobutanoic acidFormula:C7H10O4Purity:95%Molecular weight:158.154-Ethoxy-2-methylene-4-oxobutanoic acid
CAS:4-Ethoxy-2-methylene-4-oxobutanoic acidFormula:C7H10O4Purity:97%Color and Shape:SolidMolecular weight:158.15189Monoethyl itaconate
CAS:Monoethyl itaconate is a free radical that can be used for polymerizationFormula:C7H10O4Purity:99.86%Color and Shape:SolidMolecular weight:158.15Monoethyl itaconate
CAS:Formula:C7H10O4Purity:98%Color and Shape:White to very pale yellow powderMolecular weight:158.153





