CAS 57772-50-6
:2-amino-3-methylbenzyl alcohol
Description:
2-Amino-3-methylbenzyl alcohol, with the CAS number 57772-50-6, is an organic compound characterized by the presence of an amino group (-NH2) and a hydroxyl group (-OH) attached to a benzene ring that also features a methyl group (-CH3). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and organic solvents, which is indicative of its polar functional groups. The amino group contributes to its basicity, while the hydroxyl group provides it with alcohol characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Its structure allows for hydrogen bonding, which can influence its physical properties, such as boiling and melting points. Additionally, 2-amino-3-methylbenzyl alcohol may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H11NO
InChI:InChI=1/C8H11NO/c1-6-3-2-4-7(5-10)8(6)9/h2-4,10H,5,9H2,1H3
SMILES:Cc1cccc(CO)c1N
Synonyms:- (2-Amino-3-Methylphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-3-methylbenzyl alcohol
CAS:2-Amino-3-methylbenzyl alcoholFormula:C8H11NOPurity:98%Color and Shape:SolidMolecular weight:137.17903(2-Amino-3-methylphenyl)methanol
CAS:Formula:C8H11NOPurity:95%Color and Shape:SolidMolecular weight:137.1790(2-Amino-3-methylphenyl)methanol
CAS:Formula:C8H11NOPurity:98%Color and Shape:SolidMolecular weight:137.182(2-Amino-3-methylphenyl)methanol
CAS:Controlled ProductApplications (2-Amino-3-methylphenyl)methanol is a useful research chemical for organic synthesis and other chemical processes.
References Dev, K., et al.: Tetrahedron Lett., 58, 1202 (2017); Xu, C., et al.: Tetrahedron, 73, 1904 (2017); Jia, H., et al.: Org. Lett., 19, 5236 (2017)Formula:C8H11NOColor and Shape:NeatMolecular weight:137.18



