CymitQuimica logo

CAS 57780-86-6

:

Mometasone Furoate EP Impurity M

Description:
Mometasone Furoate EP Impurity M, with the CAS number 57780-86-6, is a chemical compound that is recognized as an impurity associated with the corticosteroid mometasone furoate, which is used primarily for its anti-inflammatory properties in various medical applications, particularly in dermatology and respiratory treatments. This impurity may arise during the synthesis or degradation of mometasone furoate and is typically characterized by its molecular structure, which includes specific functional groups that contribute to its chemical behavior. The compound is generally analyzed using techniques such as high-performance liquid chromatography (HPLC) to ensure quality control in pharmaceutical formulations. Its presence is monitored to maintain the purity and efficacy of the final product, as impurities can affect the safety and effectiveness of medications. While specific physical and chemical properties such as solubility, melting point, and spectral data may vary, the characterization of impurities like Mometasone Furoate EP Impurity M is crucial for regulatory compliance and therapeutic efficacy.
Formula:C32H32Cl2O8
InChI:InChI=1S/C22H29ClO4/c1-12-9-17-16-6-5-14-10-15(25)7-8-19(14,3)21(16,23)18(26)11-20(17,4)22(12,27)13(2)24/h7-8,10,12,16-18,26-27H,5-6,9,11H2,1-4H3/t12-,16+,17+,18+,19+,20+,21+,22+/m1/s1
InChI key:PPHLHSSXDSBOAQ-QAHQDLQKSA-N
SMILES:C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)C)O)C)O)Cl)C
Synonyms:
  • Mometasone Impurity M
  • Mometasone EP Impurity M
  • (8S,9R,10S,11S,13S,14S,16R,17R)-17-acetyl-9-chloro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-one
  • 9-Chloro-11β,17-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione
  • Mometasone Furoate EP Impurity M
  • Mometasone Furoate Impurity 13(Mometasone Furoate EP Impurity M)
  • (11β,16α)-9-Chloro-11,17-dihydroxy-16-methyl-pregna-1,4-diene-3,20-dione (Mometasone Impurity M)
Found 5 products.