CAS 57883-25-7
:3-Bromo-2-ethoxypyridine
Description:
3-Bromo-2-ethoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and an ethoxy group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the ethoxy group. 3-Bromo-2-ethoxypyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its bromine substituent can serve as a useful handle for further functionalization. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H8BrNO
InChI:InChI=1/C7H8BrNO/c1-2-10-7-6(8)4-3-5-9-7/h3-5H,2H2,1H3
SMILES:CCOc1c(cccn1)Br
Synonyms:- 2-Ethoxy-3-bromopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-2-ethoxypyridine, 95%
CAS:3-Bromo-2-ethoxypyridin is an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy bFormula:C7H8BrNOPurity:95%Color and Shape:Liquid, Clear pale yellow to yellowMolecular weight:202.053-Bromo-2-Ethoxypyridine
CAS:Formula:C7H8BrNOPurity:95%Color and Shape:LiquidMolecular weight:202.04853-Bromo-2-ethoxypyridine
CAS:3-Bromo-2-ethoxypyridineFormula:C7H8BrNOPurity:98%Molecular weight:202.048523-Bromo-2-ethoxypyridine
CAS:Formula:C7H8BrNOPurity:98%Color and Shape:LiquidMolecular weight:202.051



