CAS 57900-42-2
:Sulfonium, triphenyl-, hexafluoroarsenate(1-) (1:1)
Description:
Triphenylsulfonium hexafluoroarsenate (1-) is an organosulfur compound characterized by the presence of a sulfonium ion, where a sulfur atom is bonded to three phenyl groups and carries a positive charge. This compound is paired with the hexafluoroarsenate anion, which consists of an arsenic atom surrounded by six fluorine atoms, imparting significant stability and unique properties. The sulfonium ion is known for its role in various chemical reactions, particularly in organic synthesis, where it can act as a strong electrophile. The hexafluoroarsenate anion contributes to the compound's overall ionic character and enhances its solubility in polar solvents. Additionally, the presence of fluorine atoms in the anion can influence the compound's reactivity and stability, making it useful in specialized applications, including as a reagent in organic chemistry. Overall, triphenylsulfonium hexafluoroarsenate (1-) is notable for its unique structural features and its utility in synthetic chemistry.
Formula:C18H15AsF6S
InChI:InChI=1/C18H15S.AsF6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4,5,6)7/h1-15H;/q+1;-1
InChI key:InChIKey=SYENPFUVTQGHIM-UHFFFAOYSA-N
SMILES:[S+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[As+5]([F-])([F-])([F-])([F-])([F-])[F-]
Synonyms:- Arsenate(1-), hexafluoro-, triphenylsulfonium
- Sulfonium, triphenyl-, hexafluoroarsenate(1-)
- Sulfonium, triphenyl-, hexafluoroarsenate(1-) (1:1)
- Triphenylsulfonium
- Triphenylsulfonium Hexafluoroarsenate(1-)
- Triphenylsulfonium hexafluoroarsenate
- Triphenylsulphonium hexafluoroarsenate(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
