CAS 5792-36-9: 2′,4′-Dihydroxypropiophenone
Description:2′,4′-Dihydroxypropiophenone, with the CAS number 5792-36-9, is an organic compound characterized by its phenolic structure, which includes two hydroxyl (-OH) groups attached to a propiophenone backbone. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of hydroxyl groups contributes to its reactivity, allowing it to participate in hydrogen bonding and other chemical interactions. It may exhibit antioxidant properties due to its ability to donate hydrogen atoms, which can neutralize free radicals. Additionally, 2′,4′-Dihydroxypropiophenone can serve as an intermediate in organic synthesis, particularly in the development of more complex molecules. Its solubility characteristics can vary depending on the solvent used, and it is important to handle this compound with care, following appropriate safety protocols, as with any chemical substance. Overall, its unique structure and properties make it a subject of interest in both research and industrial applications.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-2-8(11)7-4-3-6(10)5-9(7)12/h3-5,10,12H,2H2,1H3
InChI key:InChIKey=LLBBBYLDTDJMNU-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C(O)C=C1O)CC
- Synonyms:
- Resopropiophenone
- 4-Propionylresorcinol
- Propiophenone, 2′,4′-dihydroxy-
- 1-(2,4-Dihydroxyphenyl)-1-propanone
- 1-Propanone, 1-(2,4-dihydroxyphenyl)-
