CymitQuimica logo

CAS 579515-63-2

:

Benzenesulfonamide,3-[[4-[methyl[4-[[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]amino]phenyl]amino]-2-pyrimidinyl]amino]-

Description:
Benzenesulfonamide, specifically the compound with the CAS number 579515-63-2, is a complex organic molecule characterized by its sulfonamide functional group, which is a key feature in many pharmaceuticals. This compound contains multiple aromatic rings and substituents, including trifluoromethoxy and various amino groups, which contribute to its potential biological activity. The presence of the pyrimidine ring suggests that it may interact with biological targets such as enzymes or receptors, making it of interest in medicinal chemistry. The trifluoromethoxy group can enhance lipophilicity and metabolic stability, while the amino groups may facilitate hydrogen bonding and interactions with biological macromolecules. Overall, this compound's structure indicates potential applications in drug development, particularly in targeting specific pathways or diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods to determine its efficacy and safety in potential therapeutic applications.
Formula:C25H22F3N7O4S
InChI:InChI=1S/C25H22F3N7O4S/c1-35(22-13-14-30-23(34-22)31-18-3-2-4-21(15-18)40(29,37)38)19-9-5-16(6-10-19)32-24(36)33-17-7-11-20(12-8-17)39-25(26,27)28/h2-15H,1H3,(H2,29,37,38)(H,30,31,34)(H2,32,33,36)
InChI key:SNRUTMWCDZHKKM-UHFFFAOYSA-N
SMILES:CN(C1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)C3=NC(=NC=C3)NC4=CC(=CC=C4)S(=O)(=O)N
Found 7 products.