CAS 579515-63-2
:Benzenesulfonamide,3-[[4-[methyl[4-[[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]amino]phenyl]amino]-2-pyrimidinyl]amino]-
Description:
Benzenesulfonamide, specifically the compound with the CAS number 579515-63-2, is a complex organic molecule characterized by its sulfonamide functional group, which is a key feature in many pharmaceuticals. This compound contains multiple aromatic rings and substituents, including trifluoromethoxy and various amino groups, which contribute to its potential biological activity. The presence of the pyrimidine ring suggests that it may interact with biological targets such as enzymes or receptors, making it of interest in medicinal chemistry. The trifluoromethoxy group can enhance lipophilicity and metabolic stability, while the amino groups may facilitate hydrogen bonding and interactions with biological macromolecules. Overall, this compound's structure indicates potential applications in drug development, particularly in targeting specific pathways or diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods to determine its efficacy and safety in potential therapeutic applications.
Formula:C25H22F3N7O4S
InChI:InChI=1S/C25H22F3N7O4S/c1-35(22-13-14-30-23(34-22)31-18-3-2-4-21(15-18)40(29,37)38)19-9-5-16(6-10-19)32-24(36)33-17-7-11-20(12-8-17)39-25(26,27)28/h2-15H,1H3,(H2,29,37,38)(H,30,31,34)(H2,32,33,36)
InChI key:SNRUTMWCDZHKKM-UHFFFAOYSA-N
SMILES:CN(C1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)C3=NC(=NC=C3)NC4=CC(=CC=C4)S(=O)(=O)N
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
GW806742X
CAS:GW806742X inhibits MLKL with Kd 9.3 μM, preventing necroptosis; also targets VEGFR2.Formula:C25H22F3N7O4SPurity:98.3%Color and Shape:SolidMolecular weight:573.5473-((4-(Methyl(4-(3-(4-(Trifluoromethoxy)Phenyl)Ureido)Phenyl)Amino)Pyrimidin-2-Yl)Amino)Benzenesulfonamide
CAS:3-((4-(Methyl(4-(3-(4-(Trifluoromethoxy)Phenyl)Ureido)Phenyl)Amino)Pyrimidin-2-Yl)Amino)BenzenesulfonamideFormula:C25H22F3N7O4SPurity:>98%Molecular weight:573.55GW806742X
CAS:3-((4-(Methyl(4-(3-(4-(trifluoromethoxy)phenyl)ureido)phenyl)amino)pyrimidin-2-yl)amino)benzenesulfonamideFormula:C25H22F3N7O4SPurity:98%Molecular weight:573.553-((4-(Methyl(4-(3-(4-(trifluoromethoxy)phenyl)ureido)phenyl)amino)pyrimidin-2-yl)amino)benzenesulfonamide
CAS:Purity:98%Molecular weight:573.5499878GW806742X
CAS:GW806742X is a potent and selective inhibitor of caspase-independent cell death. It provides a new therapeutic option for the treatment of inflammatory diseases, bowel disease, and leukemia. GW806742X has been shown to inhibit the activation of aurora kinases, which are key regulators in the inflammatory response. The compound also blocks necroptosis induced by complement-dependent cytotoxicity or cellular inflammatory stimuli. GW806742X inhibits the release of proinflammatory cytokines and chemokines such as IL-1β and TNFα, which may be due to its ability to block NF-κB activity.Formula:C25H22F3N7O4SPurity:Min. 95%Molecular weight:573.55 g/mol





