CAS 5799-67-7
:dimethyl(methylthio)sulfonium tetra-fluoroborate
Description:
Dimethyl(methylthio)sulfonium tetrafluoroborate, with the CAS number 5799-67-7, is an organosulfur compound that serves as a quaternary ammonium salt. It features a dimethylsulfonium cation, which is characterized by the presence of a sulfur atom bonded to two methyl groups and a methylthio group, along with a tetrafluoroborate anion. This compound is typically a white crystalline solid and is known for its stability and solubility in polar solvents. It is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of sulfur-containing compounds. The tetrafluoroborate anion contributes to its ionic character, enhancing its reactivity in nucleophilic substitution reactions. Additionally, due to its unique structure, it may exhibit interesting properties such as ionic conductivity and potential applications in electrochemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C14H15F3N2O3
InChI:InChI=1/C14H15F3N2O3/c1-3-10-8-13(21,14(15,16)17)19(18-10)12(20)9-4-6-11(22-2)7-5-9/h4-7,21H,3,8H2,1-2H3
SMILES:CCC1=NN(C(=O)c2ccc(cc2)OC)C(C1)(C(F)(F)F)O
Synonyms:- Dimethyl(methylthio)sulfonium tetrafluoroborate
- Trimethyldisulfanium Tetrafluoroborate
- 3-ethyl-1-[(4-methoxyphenyl)carbonyl]-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dimethyl(methylthio)sulfonium Tetrafluoroborate
CAS:Formula:C3H9BF4S2Purity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:196.03Dimethyl(methylthio)sulfonium Tetrafluoroborate
CAS:Formula:C3H9BF4S2Purity:97.0%Color and Shape:SolidMolecular weight:196.0382Trimethyldisulphanium tetrafluoroborate
CAS:Trimethyldisulphanium tetrafluoroboratePurity:>97.0%Molecular weight:196.04g/molDimethyl(methylthio)sulfonium Tetrafluoroborate
CAS:Dimethyl(methylthio)sulfonium Tetrafluoroborate (DMTSBF) is a synthetic, activated, nucleophilic reagent that has the ability to cleave disulfide bonds in proteins. DMTSBF is used for the synthesis of fatty acids and other organic compounds. It can also be used as an analytical reagent for determining the blood group of proteins. The chloride ion is necessary for this reaction. DMTSBF reacts with a nucleophile (e.g., hydroxyl, amine, thiol) to form a new bond and release sodium carbonate and silver trifluoromethanesulfonate.
Formula:C3H9BF4S2Purity:Min. 95%Color and Shape:PowderMolecular weight:196.04 g/mol



