CymitQuimica logo

CAS 5799-67-7

:

dimethyl(methylthio)sulfonium tetra-fluoroborate

Description:
Dimethyl(methylthio)sulfonium tetrafluoroborate, with the CAS number 5799-67-7, is an organosulfur compound that serves as a quaternary ammonium salt. It features a dimethylsulfonium cation, which is characterized by the presence of a sulfur atom bonded to two methyl groups and a methylthio group, along with a tetrafluoroborate anion. This compound is typically a white crystalline solid and is known for its stability and solubility in polar solvents. It is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of sulfur-containing compounds. The tetrafluoroborate anion contributes to its ionic character, enhancing its reactivity in nucleophilic substitution reactions. Additionally, due to its unique structure, it may exhibit interesting properties such as ionic conductivity and potential applications in electrochemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C14H15F3N2O3
InChI:InChI=1/C14H15F3N2O3/c1-3-10-8-13(21,14(15,16)17)19(18-10)12(20)9-4-6-11(22-2)7-5-9/h4-7,21H,3,8H2,1-2H3
InChI key:LUOOXKXNWLQGLY-UHFFFAOYSA-N
SMILES:CCC1=NN(C(=O)c2ccc(cc2)OC)C(C1)(C(F)(F)F)O
Synonyms:
  • Dimethyl(methylthio)sulfonium tetrafluoroborate
  • Trimethyldisulfanium Tetrafluoroborate
  • 3-ethyl-1-[(4-methoxyphenyl)carbonyl]-5-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-ol
Found 4 products.