CAS 58-90-2: 2,3,4,6-Tetrachlorophenol
Description:2,3,4,6-Tetrachlorophenol (CAS 58-90-2) is a chlorinated aromatic compound characterized by the presence of four chlorine atoms attached to a phenolic ring. This compound is typically a white to pale yellow solid at room temperature and is known for its high solubility in organic solvents, while being less soluble in water. It exhibits a strong, distinctive odor and is often used as a biocide, fungicide, and herbicide in various agricultural applications. The presence of multiple chlorine atoms enhances its antimicrobial properties, making it effective against a wide range of microorganisms. However, 2,3,4,6-tetrachlorophenol is also associated with environmental concerns due to its persistence and potential toxicity to aquatic life and humans. It can undergo various degradation processes, but its chlorinated structure makes it resistant to complete breakdown. Safety precautions are essential when handling this compound, as it may pose health risks, including skin and respiratory irritation, and potential long-term effects with exposure.
Formula:C6H2Cl4O
InChI:InChI=1S/C6H2Cl4O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H
InChI key:InChIKey=VGVRPFIJEJYOFN-UHFFFAOYSA-N
SMILES:ClC=1C=C(Cl)C(O)=C(Cl)C1Cl
- Synonyms:
- 2,3,4,6-Tetrachlorophenate
- 2,3,4,6-Tetrachlorphenol
- 2,3,4,6-Tetraclorofenol
- 2,4,5,6-Tetrachlorophenol
- Dowicide 6
- Nsc 2428
- Phenol, 2,3,4,6-tetrachloro-
- TCP
- 2,3,4,6-Tetrachlorophenol
