CAS 5807-81-8
:2-Diphenylmethyl piperidine hcl
Description:
2-Diphenylmethyl piperidine hydrochloride, with the CAS number 5807-81-8, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features two phenyl groups attached to a carbon atom adjacent to the nitrogen, contributing to its lipophilicity and potential biological activity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and facilitates its use in various applications, including medicinal chemistry. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in pharmacological research. Its properties may include moderate to high melting points and stability under standard conditions, although specific values can vary based on purity and environmental factors. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C18H22ClN
InChI:InChI=1/C18H21N.ClH/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17;/h1-6,9-12,17-19H,7-8,13-14H2;1H
InChI key:NTADPDIPKMRRQV-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c1ccccc1)C1CCCCN1.Cl
Synonyms:- 2-(Diphenylmethyl)piperidine hydrochloride (1:1)
- Piperidine, 2-(Diphenylmethyl)-, Hydrochloride (1:1)
- 2-Benzhydrylpiperidine Hydrochloride
- 2-Diphenylmethylpiperidine Hydrochloride
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Benzhydrylpiperidine Hydrochloride
CAS:Controlled ProductApplications 2-Benzhydrylpiperidine hydrochloride (cas# 5807-81-8) is a useful research chemical.
Formula:C18H21N·ClHColor and Shape:NeatMolecular weight:287.83

