CymitQuimica logo

CAS 58096-66-5

:

Uridine, 4',5'-didehydro-2',5'-dideoxy-

Description:
Uridine, 4',5'-didehydro-2',5'-dideoxy- (CAS 58096-66-5) is a modified nucleoside that features alterations in its sugar and base components. This compound is characterized by the absence of hydroxyl groups at the 2' and 5' positions of the ribose sugar, which contributes to its stability and resistance to enzymatic degradation. The 4',5'-didehydro modification introduces a double bond in the sugar moiety, further influencing its biochemical properties. As a nucleoside analog, it may exhibit unique interactions with nucleic acid synthesis pathways and can potentially serve as a substrate for various enzymes. Its structural modifications can affect its biological activity, making it of interest in research related to antiviral therapies and nucleic acid chemistry. Additionally, the compound's solubility, polarity, and reactivity can differ significantly from those of standard nucleosides, impacting its application in biochemical studies and pharmaceutical development. Overall, this compound represents a significant area of study in the field of medicinal chemistry and molecular biology.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-5-6(12)4-8(15-5)11-3-2-7(13)10-9(11)14/h2-3,6,8,12H,1,4H2,(H,10,13,14)/t6-,8+/m0/s1
InChI key:GWUGJFCGJLMLER-POYBYMJQSA-N
SMILES:C=C1[C@H](C[C@@H](O1)N2C=CC(=O)NC2=O)O
Found 1 products.