CymitQuimica logo

CAS 581-80-6

:

4,4'-bis(trifluoromethyl)-1,1'-biphenyl

Description:
4,4'-Bis(trifluoromethyl)-1,1'-biphenyl, with the CAS number 581-80-6, is an organic compound characterized by its biphenyl structure substituted with two trifluoromethyl groups at the para positions. This compound is typically a solid at room temperature and is known for its high thermal stability and low volatility. The presence of trifluoromethyl groups significantly influences its chemical properties, enhancing its lipophilicity and making it useful in various applications, including as a building block in organic synthesis and in the development of advanced materials. It exhibits strong electron-withdrawing characteristics, which can affect its reactivity and interactions with other chemical species. Additionally, 4,4'-bis(trifluoromethyl)-1,1'-biphenyl is often studied for its potential applications in the fields of electronics and pharmaceuticals due to its unique electronic properties. Safety data indicates that, like many fluorinated compounds, it should be handled with care to avoid environmental and health risks.
Formula:C14H8F6
InChI:InChI=1S/C14H8F6/c15-13(16,17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(18,19)20/h1-8H
InChI key:ITBRQMPOQQZNFT-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F
Found 5 products.