CAS 5810-42-4
:Tetrapropylammonium chloride
Description:
Tetrapropylammonium chloride (TPACl) is a quaternary ammonium salt characterized by its structure, which consists of a central nitrogen atom bonded to four propyl groups and a chloride anion. It appears as a white crystalline solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. TPACl is often employed as a phase transfer catalyst in organic synthesis, facilitating the transfer of reactants between immiscible phases. Its quaternary ammonium nature imparts surfactant properties, allowing it to stabilize emulsions and enhance solubility of hydrophobic compounds in aqueous solutions. Additionally, TPACl can exhibit antimicrobial properties, making it relevant in biocidal applications. Safety considerations include handling it with care, as it may cause irritation to skin and eyes. Overall, tetrapropylammonium chloride is a versatile compound with significant utility in both industrial and laboratory settings.
Formula:C12H28N·Cl
InChI:InChI=1S/C12H28N.ClH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=FBEVECUEMUUFKM-UHFFFAOYSA-M
SMILES:[N+](CCC)(CCC)(CCC)CCC.[Cl-]
Synonyms:- (5Z)-5-[(2-methoxynaphthalen-1-yl)methylidene]-1-phenyl-2-thioxodihydropyrimidine-4,6(1H,5H)-dione
- 1-Propanaminium, N,N,N-tripropyl-, chloride
- 1-Propanaminium, N,N,N-tripropyl-, chloride (1:1)
- Ammonium, tetrapropyl-, chloride
- N,N,N-Tripropyl-1-propanaminium chloride
- Tetra-n-propylammonium chloride
- Tetrapropyl ammonium chloride
- Tetrapropylammonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Tetrapropylammonium Chloride
CAS:Formula:C12H28ClNPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:221.81Tetra-n-propylammonium chloride, 99+%
CAS:Tetra-n-propylammonium chloride is used as phase-transfer type applications. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code orFormula:C12H28ClNPurity:99+%Color and Shape:White to pale cream, Powder or crystals or crystalline powderMolecular weight:221.81Tetrapropylammonium chloride
CAS:Formula:C12H28ClNPurity:98%Color and Shape:SolidMolecular weight:221.8104Tetrapropylammonium chloride
CAS:Tetrapropylammonium chlorideFormula:C12H28ClNPurity:97%Color and Shape:SolidMolecular weight:221.81Tetrapropyl-d28-ammoniumChloride
CAS:Formula:(CD3CD2CD2)4NClPurity:98 atom % DColor and Shape:White SolidMolecular weight:249.36678Tetrapropylammonium chloride
CAS:Formula:C12H28ClNPurity:97%Color and Shape:Solid, White to almost white powderMolecular weight:221.81Tetrapropylammonium chloride
CAS:Tetrapropylammonium chlorideFormula:C12H28ClNPurity:97%Molecular weight:221.81Tetrapropylammonium Chloride (TPAC) extrapure, 98%
CAS:Formula:C12H28ClNPurity:min. 98%Color and Shape:White to off - white, Crystalline compound, ClearMolecular weight:221.81Tetra-n-propyl-d28-ammonium Chloride
CAS:Controlled ProductApplications Tetra-n-propyl-d28-ammonium Chloride is a useful isotopically labeled compound of Tetrapropylammonium Chloride (T302858)
Formula:C12D27HN·ClColor and Shape:NeatMolecular weight:249.98









