CAS 581073-80-5

Benzamide, 4-[2-(2-furanyl)-6-(4-nitrophenyl)-4-pyridinyl]-

Description:

Benzamide, 4-[2-(2-furanyl)-6-(4-nitrophenyl)-4-pyridinyl]- is a chemical compound characterized by its complex structure, which includes a benzamide moiety and multiple aromatic and heterocyclic components. The presence of a furan ring and a nitrophenyl group contributes to its potential biological activity and chemical reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interactions with biological targets. Additionally, the pyridine ring can participate in coordination with metal ions or engage in hydrogen bonding, enhancing its potential applications in medicinal chemistry. Overall, this compound's unique structural features suggest it may have interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₂₂H₁₅N₃O₄

InChI: InChI=1S/C22H15N3O4/c23-22(26)16-5-3-14(4-6-16)17-12-19(15-7-9-18(10-8-15)25(27)28)24-20(13-17)21-2-1-11-29-21/h1-13H,(H2,23,26)

InChI key: GTTDVYCKFQYVNN-UHFFFAOYSA-N

SMILES: C1=COC(=C1)C2=CC(=CC(=N2)C3=CC=C(C=C3)[N+](=O)[O-])C4=CC=C(C=C4)C(=O)N

KJ Pyr 9

CAS: 581073-80-5

KJ Pyr 9 is an MYC inhibitor (Kd: 6.5 nM in vitro assay).

Formula: C₂₂H₁₅N₃O₄

Purity: 98% - 99.56%

Color and Shape: Solid

Molecular weight: 385.37

Ref: TM-T15665

KJ Pyr 9

CAS: 581073-80-5

KJ Pyr 9

Formula: C₂₂H₁₅N₃O₄

Purity: 99.5%

Molecular weight: 385.37

Ref: 54-BUP15342

KJ Pyr 9

CAS: 581073-80-5

Formula: C₂₂H₁₅N₃O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 385.3722

Ref: IN-DA00ECG8

KJ Pyr 9

CAS: 581073-80-5

KJ Pyr 9 is an all-trans retinoic acid (ATRA) derivative that has been shown to inhibit the growth of cancer cells in vitro. KJ Pyr 9 selectively binds to the retinoid X receptor, which is a transcription factor that regulates gene expression. ATRA derivatives are also known as potential biomarkers for colorectal adenocarcinoma and cervical cancer. KJ Pyr 9 was found to be cytostatic rather than cytotoxic, meaning it inhibits cell proliferation but does not kill cells. This molecule has low expression levels and may be a target for inhibitory compounds.

Formula: C₂₂H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 385.37 g/mol

Ref: 3D-GYA07380