CymitQuimica logo

CAS 58110-57-9

:

5-(2-bromophenyl)furan-2-carbaldehyde

Description:
5-(2-Bromophenyl)furan-2-carbaldehyde is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, specifically at the 2-position, which can influence the compound's reactivity and physical properties. The aldehyde functional group (-CHO) attached to the furan ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for potential applications in materials science and medicinal chemistry, where the bromine substituent can enhance biological activity or facilitate further chemical modifications. As with many organic compounds, safety precautions should be observed when handling this substance due to its potential toxicity and reactivity.
Formula:C11H7BrO2
InChI:InChI=1/C11H7BrO2/c12-10-4-2-1-3-9(10)11-6-5-8(7-13)14-11/h1-7H
InChI key:FWPDRAIMKVWEGB-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)c1ccc(C=O)o1)Br
Synonyms:
  • 2-Furancarboxaldehyde, 5-(2-bromophenyl)-
  • 5-(2-Bromophenyl)-2-furaldehyde
  • 5-(2-Bromo-phenyl)-furan-2-carbaldehyde
Found 3 products.