CymitQuimica logo

CAS 58119-51-0

:

Benzenamine, 4-[4-(trifluoromethoxy)phenoxy]-

Description:
Benzenamine, 4-[4-(trifluoromethoxy)phenoxy]- is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with an amino group and a phenoxy group that contains a trifluoromethoxy substituent. This compound typically exhibits a white to light yellow solid appearance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding due to the amino group, which can affect its solubility and reactivity. Its chemical properties, such as melting point, boiling point, and solubility, are influenced by the substituents on the aromatic rings. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, benzenamine, 4-[4-(trifluoromethoxy)phenoxy]- is a compound of interest for further research and application in various chemical contexts.
Formula:C13H10F3NO2
InChI:InChI=1S/C13H10F3NO2/c14-13(15,16)19-12-7-5-11(6-8-12)18-10-3-1-9(17)2-4-10/h1-8H,17H2
InChI key:JROBFACAMCMLJS-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1N)OC2=CC=C(C=C2)OC(F)(F)F
Found 5 products.