CAS 58138-08-2
:Tridiphane
Description:
Tridiphane, with the CAS number 58138-08-2, is a chemical compound that belongs to the class of organic compounds known as phosphonates. It is characterized by its unique structure, which typically includes phosphorus atoms bonded to carbon and oxygen, contributing to its reactivity and potential applications. Tridiphane is often utilized in various fields, including agriculture as a pesticide or herbicide, due to its ability to interact with biological systems. Its properties may include moderate solubility in organic solvents and varying stability under different environmental conditions. Additionally, Tridiphane may exhibit specific biological activity, making it of interest for research in medicinal chemistry and agrochemicals. As with many phosphonates, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, Tridiphane represents a compound with significant utility in both industrial and research applications, warranting further investigation into its properties and effects.
Formula:C10H7Cl5O
InChI:InChI=1S/C10H7Cl5O/c11-7-1-6(2-8(12)3-7)9(5-16-9)4-10(13,14)15/h1-3H,4-5H2
InChI key:InChIKey=IBZHOAONZVJLOB-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)C1(CO1)C2=CC(Cl)=CC(Cl)=C2
Synonyms:- 2-(3,5-Dichlorphenyl)-2-(2,2,2-trichlorethyl)oxiran
- Dowco 356
- Nelpon
- Oxirane, 2-(3,5-Dichlorophenyl)-2-(2,2,2-Trichloroethyl)-
- Tridiphane
- 2-(3,5-Dichlorophenyl)-2-(2,2,2-trichloroethyl)oxirane
- 2-(3,5-Dichlorophényl)-2-(2,2,2-trichloroéthyl)oxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Tridiphane (Standard)
CAS:Tridiphane (Standard) is a reference standard of Tridiphane intended for quantitative analysis, quality control, and related biochemical research applications.Formula:C10H7Cl5OColor and Shape:SolidMolecular weight:320.43Tridiphane 10 µg/mL in Isooctane
CAS:Formula:C10H7Cl5OColor and Shape:Single SolutionMolecular weight:320.43


