CAS 58139-59-6
:2,2′-Diamino-4,4′-bithiazole
Description:
2,2′-Diamino-4,4′-bithiazole, with the CAS number 58139-59-6, is an organic compound characterized by its unique structure, which consists of two thiazole rings connected by a biphenyl linkage. This compound features two amino groups (-NH2) at the 2 and 2' positions, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of thiazole rings imparts notable properties, including potential biological activity, making it of interest in pharmaceutical research. Additionally, the amino groups can participate in various chemical reactions, such as coupling reactions, which are useful in synthesizing more complex molecules. 2,2′-Diamino-4,4′-bithiazole may also exhibit solubility in polar solvents, which can influence its application in different chemical processes. Overall, its structural features and functional groups make it a compound of interest in both synthetic and medicinal chemistry.
Formula:C6H6N4S2
InChI:InChI=1S/C6H6N4S2/c7-5-9-3(1-11-5)4-2-12-6(8)10-4/h1-2H,(H2,7,9)(H2,8,10)
InChI key:InChIKey=MRFMTBTUKQIBDI-UHFFFAOYSA-N
SMILES:NC1=NC(=CS1)C=2N=C(N)SC2
Synonyms:- 2,2′-Diamino-4,4′-bi-1,3-thiazole
- 2,2′-Diamino-4,4′-bis(1,3-thiazole)
- 2,2′-Diamino-4,4′-bithiazole
- 4,4′-Bithiazole, 2,2′-diamino-
- [4,4'-Bithiazole]-2,2'-Diamine
- 4,4'-Bi-1,3-thiazole-2,2'-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
[4,4'-Bithiazole]-2,2'-diamine
CAS:[4,4'-Bithiazole]-2,2'-diamineFormula:C6H6N4S2Purity:98%Molecular weight:198.27[4,4'-Bithiazole]-2,2'-diamine
CAS:[4,4'-Bithiazole]-2,2'-diamineFormula:C6H6N4S2Purity:97%Molecular weight:198.268642,2'-Diamino-4,4'-bithiazole
CAS:Formula:C6H6N4S2Purity:98%Color and Shape:SolidMolecular weight:198.26862,2'-Diamino-4,4'-bithiazole
CAS:2,2'-Diamino-4,4'-bithiazole (DABT) is a ligand that forms supramolecular aggregates with a variety of metal ions. It has been shown to bind to serum albumin and form an interaction that depends on the coordination geometry of the metal ion. DABT has been shown to be a fluorescent molecule with tryptophan fluorescence. The fluorescence emission spectrum of DABT is sensitive to chloride concentrations in the environment. The chemical structure and solubility properties of DABT are similar to those of chlorides; thus, it can be used as an oxidant at low pH levels.Formula:C6H6N4S2Purity:Min. 95%Color and Shape:PowderMolecular weight:198.27 g/mol2,2'-Diamino-4,4'-bithiazole
CAS:Formula:C6H6N4S2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:198.26





