CymitQuimica logo

CAS 5825-71-8

:

dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate

Description:
Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate is an organic compound characterized by its pyrazolo-pyridine structure, which features a fused ring system. This compound contains two carboxylate ester groups, contributing to its reactivity and solubility properties. Typically, it appears as a crystalline solid and is soluble in polar organic solvents. The presence of the dimethyl ester groups enhances its lipophilicity, making it potentially useful in various chemical reactions and applications, including medicinal chemistry and material science. The compound may exhibit biological activity, which has been a subject of research, particularly in the context of its potential as a pharmacophore. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate is a significant compound in the realm of organic chemistry with potential applications in various fields.
Formula:C11H10N2O4
InChI:InChI=1/C11H10N2O4/c1-16-10(14)8-7-5-3-4-6-13(7)12-9(8)11(15)17-2/h3-6H,1-2H3
InChI key:NZJIUQJPKXRRHB-UHFFFAOYSA-N
SMILES:COC(=O)c1c2ccccn2nc1C(=O)OC
Synonyms:
  • Pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid, dimethyl ester
  • Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate
Found 3 products.