CymitQuimica logo

CAS 58375-08-9

:

2(1H)-Quinolinone, 3-acetyl-6-chloro-4-phenyl-

Description:
2(1H)-Quinolinone, 3-acetyl-6-chloro-4-phenyl- is an organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing a benzene ring and a pyridine-like nitrogen. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. The presence of the acetyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including acylation and condensation. The chloro substituent at the 6-position and the phenyl group at the 4-position contribute to its unique chemical properties, influencing its reactivity and potential applications in medicinal chemistry. Compounds of this nature are often studied for their biological activities, including antimicrobial and anticancer properties. Additionally, the compound's structure allows for potential modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity in pharmacological applications. As with many quinolinone derivatives, it may also exhibit fluorescence, making it useful in various analytical applications.
Formula:C17H12ClNO2
InChI:InChI=1S/C17H12ClNO2/c1-10(20)15-16(11-5-3-2-4-6-11)13-9-12(18)7-8-14(13)19-17(15)21/h2-9H,1H3,(H,19,21)
InChI key:AJBGMDVXSIBMLC-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C2=C(C=CC(=C2)Cl)NC1=O)C3=CC=CC=C3
Synonyms:
  • 1-(6-Chloro-2-Hydroxy-4-Phenylquinolin-3-Yl)Ethanone
Found 3 products.