CAS 58452-00-9
:3-Benzyloxy-4-methoxybenzoic acid
Description:
3-Benzyloxy-4-methoxybenzoic acid, with the CAS number 58452-00-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a benzyloxy group and a methoxy group. This compound typically exhibits properties associated with aromatic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of the benzyloxy and methoxy substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical applications. Its melting point, boiling point, and specific reactivity would depend on the purity and specific conditions under which it is studied. Overall, 3-Benzyloxy-4-methoxybenzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C15H14O4
InChI:InChI=1S/C15H14O4/c1-18-13-8-7-12(15(16)17)9-14(13)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17)
InChI key:InChIKey=YPDXIGBSOBESNI-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OC)C=CC(C(O)=O)=C2
Synonyms:- 3-Benzyloxy-p-anisic acid
- 4-Methoxy-3-(phenylmethoxy)benzoic acid
- Benzoic acid, 3-(benzyloxy)-4-methoxy-
- Benzoic acid, 4-methoxy-3-(phenylmethoxy)-
- 3-Benzyloxy-4-methoxybenzoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-(Benzyloxy)-4-methoxybenzoic acid
CAS:3-(Benzyloxy)-4-methoxybenzoic acidFormula:C15H14O4Purity:>96%Molecular weight:258.273-(benzyloxy)-4-methoxybenzoic acid
CAS:Formula:C15H14O4Purity:98%Color and Shape:SolidMolecular weight:258.26933-(Benzyloxy)-4-methoxybenzoic acid
CAS:3-(Benzyloxy)-4-methoxybenzoic acidFormula:C15H14O4Purity:97%Molecular weight:258.273-Benzyloxy-4-methoxybenzoic acid
CAS:3-Benzyloxy-4-methoxybenzoic acid is a natural product that was isolated as a yellow crystalline powder from the needles of the tree Kirkia. It can be used as a radical and has been shown to have frameworks with galanthamine. 3-Benzyloxy-4-methoxybenzoic acid has been shown to be an inhibitor of protein synthesis in cells, which may be due to its ability to inhibit the activity of ribosomes and protein synthesis.Formula:C15H14O4Purity:Min. 95%Molecular weight:258.27 g/mol




