CymitQuimica logo

CAS 58472-36-9

:

7-fluoro-2-hydroxy-naphthalene-1,4-dione

Description:
7-Fluoro-2-hydroxy-naphthalene-1,4-dione, also known as 7-fluoro-1,4-naphthoquinone, is a chemical compound characterized by its naphthalene backbone with specific functional groups that contribute to its reactivity and properties. This compound features a fluorine atom at the 7-position and a hydroxyl group at the 2-position, along with two carbonyl groups at the 1 and 4 positions, which are characteristic of naphthoquinones. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and concentration. The compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities and applications in dye chemistry. As with many naphthoquinones, it may also exhibit antioxidant properties and could be involved in redox reactions. Proper handling and safety measures are essential due to its potential toxicity and reactivity.
Formula:C10H5FO3
InChI:InChI=1/C10H5FO3/c11-5-1-2-6-7(3-5)10(14)9(13)4-8(6)12/h1-4,13H
InChI key:YSMKKMPXFYTUKK-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)C(=O)C(=CC2=O)O
Synonyms:
  • 1,4-Naphthalenedione, 7-Fluoro-2-Hydroxy-
  • 7-Fluoro-2-hydroxy-1,4-naphthoquinone
Found 4 products.