CAS 58479-61-1
:tert-Butyldiphenylsilyl chloride
Description:
Tert-Butyldiphenylsilyl chloride, with the CAS number 58479-61-1, is an organosilicon compound characterized by the presence of a tert-butyl group and two phenyl groups attached to a silicon atom, along with a chloride functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly as a silylating agent in organic synthesis. It is commonly used to protect hydroxyl groups in alcohols and phenols during various chemical reactions, facilitating the formation of silyl ethers. The presence of the bulky tert-butyl group imparts steric hindrance, which can influence the selectivity and reactivity of the compound in synthetic applications. Additionally, tert-butyldiphenylsilyl chloride is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of unwanted byproducts. Overall, its unique structure and reactivity make it a valuable tool in the field of organic chemistry, particularly in the synthesis of complex molecules.
Formula:C16H19ClSi
InChI:InChI=1S/C16H19ClSi/c1-16(2,3)18(17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3
InChI key:InChIKey=MHYGQXWCZAYSLJ-UHFFFAOYSA-N
SMILES:[Si](C(C)(C)C)(Cl)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- (1,1-Dimethylethyl)diphenylsilyl chloride
- (Chloro)(tert-butyl)diphenylsilane
- 1,1′-[Chloro(1,1-dimethylethyl)silylene]bis[benzene]
- Benzene, 1,1'-[chloro(1,1-dimethylethyl)silylene]bis-
- Chloro(1,1-dimethylethyl)diphenylsilane
- Chlorodiphenyl-tert-butylsilane
- Diphenyl-tert-butylsilyl chloride
- Nsc 617386
- Silane, Tert-Butyl-Diphenylchloro-
- TBDPSCl
- TDBPSCl
- Terc-Butilclorodifenilsilano
- t-Butylchlorodiphenylsilane
- t-Butyldiphenylchlorosilane
- tert-Butylchlordiphenylsilan
- tert-Butylchlorodiphenylsilane
- tert-Butyldiphenylchlorosilane
- tert-Butyldiphenylsilyl chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
tert-Butyldiphenylchlorosilane
CAS:Formula:C16H19ClSiPurity:>97.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:274.86tert-Butyldiphenylchlorosilane, 97%
CAS:tert-Butyldiphenylchlorosilane acts as a silylating reagent used to protect alcohols and in the preparation of silyl ethers. It plays a major role as a raw material and a precursor in organic synthesis and pharmaceuticals. It is also used for the synthesis of interphenylene phenyloxazoles which canFormula:C16H19ClSiPurity:97%Color and Shape:Liquid, Clear colorless to yellow or pinkMolecular weight:274.86(tert-Butyl)(chloro)diphenylsilane
CAS:(tert-Butyl)(chloro)diphenylsilaneFormula:C16H19ClSiPurity:≥95%Color and Shape:Colourless Liquid-ClearMolecular weight:274.86056tert-Butyldiphenylchlorosilane
CAS:Formula:C16H19ClSiPurity:98%Color and Shape:LiquidMolecular weight:274.8606Ref: IN-DA0035NJ
5kgTo inquire10kgTo inquire4x1kgTo inquire5g20.00€25g25.00€10g27.00€50g37.00€100g49.00€250g85.00€500g126.00€1kg162.00€tert-Butyl diphenylchlorosilane
CAS:Tert-butyl diphenylchlorosilane is a chemical compound that belongs to the group of organosilicon compounds. It is used for the preparation of various organosilicon compounds, such as trifluoroacetic acid, which is used in analytical chemistry. The synthesis of tert-butyl diphenylchlorosilane starts with the reaction between hydrochloric acid and sodium citrate. This yields a phosphate bond and a hydroxyl group. In order to form the desired product, tert-butyl diphenylchlorosilane, this intermediate is reacted with trifluoroacetic acid in an asymmetric synthesis to yield the desired product. The reaction mechanism of this process involves hydrogen chloride as an electrophile attacking the carbonyl carbon atom in trifluoroacetic acid, leading to an elimination reaction. This elimination reaction results in two possible products: tert-butyl acetate or tert-butyl chlorosFormula:C16H19ClSiPurity:Min. 97 Area-%Color and Shape:Clear LiquidMolecular weight:274.87 g/moltert-Butyldiphenylchlorosilane
CAS:Controlled ProductApplications tert-Butyldiphenylchlorosilane is used to synthesize interphenylene phenyloxazoles, compounds that have antagonistic activity against thromboxane receptors which can be used for treatment of circulatory disorders, angina and stroke.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Hadjipavlou–Litina, D. & Kontogiorgis, C.: Int. Elect. J. Mol. Des., 1, 300 (2002); Misra, R., et al.: Bioorg. Med. Chem. Lett., 2, 937 (1992)Formula:C16H19ClSiColor and Shape:NeatMolecular weight:274.86tert-Butylchlorodiphenylsilane (TBDPSCl) Reagent Grade, 98%
CAS:Formula:C16H19ClSiPurity:min. 98%Color and Shape:Clear, Colourless to slight yellow, LiquidMolecular weight:274.86







