CAS 58483-95-7
:5-Amino-2-chloroisonicotinic acid
Description:
5-Amino-2-chloroisonicotinic acid is a chemical compound characterized by its amino and chloro functional groups attached to an isonicotinic acid structure. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the chloro group (-Cl) can influence its reactivity and solubility in various solvents. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of antimicrobial agents or as intermediates in organic synthesis. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's properties, such as melting point, solubility, and stability, can vary depending on environmental conditions and the presence of other chemical species. Overall, 5-Amino-2-chloroisonicotinic acid is a versatile compound with significant implications in medicinal chemistry and organic synthesis.
Formula:C6H5ClN2O2
InChI:InChI=1S/C6H5ClN2O2/c7-5-1-3(6(10)11)4(8)2-9-5/h1-2H,8H2,(H,10,11)
InChI key:InChIKey=WCZUTMZMEAPPIX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=CN=C(Cl)C1
Synonyms:- 3-Amino-6-chloroisonicotinic acid
- 4-Pyridinecarboxylic Acid, 5-Amino-2-Chloro-
- 5-Amino-2-chloro-4-pyridinecarboxylic acid
- 5-Amino-2-chloroisonicotinic acid
- 5-Amino-2-chloropyridine-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-amino-2-chloropyridine-4-carboxylic acid
CAS:Formula:C6H5ClN2O2Purity:98%Color and Shape:SolidMolecular weight:172.56915-Amino-2-chloroisonicotinic acid
CAS:5-Amino-2-chloroisonicotinic acidFormula:C6H5ClN2O2Purity:97%Color and Shape:PowderMolecular weight:172.57g/mol5-Amino-2-chloroisonicotinic acid
CAS:Formula:C6H5ClN2O2Purity:95%Color and Shape:SolidMolecular weight:172.573-Amino-6-chloroisonicotinic Acid
CAS:Controlled ProductFormula:C6H5ClN2O2Color and Shape:NeatMolecular weight:172.5695-Amino-2-chloropyridine-4-carboxylic acid
CAS:5-Amino-2-chloropyridine-4-carboxylic acid is a potent tyrosine kinase inhibitor. It inhibits the activation of EGFR, which may be due to its binding to the ATP-binding pocket in EGFR. 5-Amino-2-chloropyridine-4-carboxylic acid has been shown to inhibit cancer cell growth and induce apoptosis in vitro. This drug has also been shown to have potent anticancer activity in vivo, as well as inhibitory effect on tumor growth in xenograft models of human cancer cells. In addition, it inhibits the production of formamidine acetate, a precursor for histamine synthesis. 5-Amino-2-chloropyridine-4-carboxylic acid binds to formamide and formamidine acetate with high affinity and therefore inhibits histamine synthesis.Formula:C6H5ClN2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:172.57 g/mol




