CymitQuimica logo

CAS 585-45-5

:

2-{[3-(trifluoromethyl)phenoxy]methyl}oxirane

Description:
2-{[3-(Trifluoromethyl)phenoxy]methyl}oxirane, commonly known as a type of epoxide, is characterized by its unique structural features, including an oxirane ring and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its chemical stability and lipophilicity, making it useful in various applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The oxirane ring contributes to its reactivity, allowing it to participate in nucleophilic ring-opening reactions, which are valuable in organic synthesis. This compound is typically a colorless liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to potential toxicity and reactivity, particularly in the presence of nucleophiles. Additionally, its unique properties make it a subject of interest in materials science and medicinal chemistry, where it can serve as a building block for more complex molecules. Safety data sheets should be consulted for proper handling and disposal guidelines.
Formula:C10H9F3O2
InChI:InChI=1/C10H9F3O2/c11-10(12,13)7-2-1-3-8(4-7)14-5-9-6-15-9/h1-4,9H,5-6H2
InChI key:NBXFAQFMTDGEQN-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OCC1CO1)C(F)(F)F
Found 4 products.