CymitQuimica logo

CAS 58536-46-2

:

4-(4-Bromo-phenyl)-2,6-diphenyl-pyrimidine

Description:
4-(4-Bromo-phenyl)-2,6-diphenyl-pyrimidine, with the CAS number 58536-46-2, is an organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 2 and 4. This compound features two phenyl groups at the 2 and 6 positions of the pyrimidine ring, enhancing its aromatic character and potentially influencing its electronic properties. The presence of a bromo substituent at the para position of one of the phenyl groups introduces halogen functionality, which can affect the compound's reactivity and solubility. Typically, compounds of this nature are of interest in medicinal chemistry and materials science due to their potential biological activity and utility in organic synthesis. The molecular structure suggests that it may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Additionally, the bromine atom can serve as a site for further chemical modifications, expanding its utility in various synthetic pathways.
Formula:C22H15BrN2
InChI:InChI=1S/C22H15BrN2/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)24-22(25-21)18-9-5-2-6-10-18/h1-15H
InChI key:GHDBFGUOBVYEOV-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Br
Found 5 products.