CAS 58543-17-2
:Rebaudioside B
Description:
Rebaudioside B is a natural glycoside derived from the leaves of the Stevia rebaudiana plant, commonly known for its use as a non-caloric sweetener. It belongs to the class of steviol glycosides, which are known for their intense sweetness, often exceeding that of sucrose. Rebaudioside B is characterized by its high sweetness potency, low caloric content, and minimal impact on blood glucose levels, making it a popular choice for sugar substitutes in food and beverage products. The compound is stable under heat and acidic conditions, which allows it to be used in various cooking and baking applications. In terms of its chemical structure, Rebaudioside B consists of a steviol backbone with multiple sugar moieties attached, contributing to its sweetness profile. It is generally recognized as safe (GRAS) by food safety authorities when used within established guidelines. Additionally, Rebaudioside B has been studied for potential health benefits, including antioxidant properties, although further research is needed to fully understand its effects.
Formula:C38H60O18
InChI:InChI=1/C38H60O18/c1-16-11-37-9-5-20-35(2,7-4-8-36(20,3)34(49)50)21(37)6-10-38(16,15-37)56-33-30(55-32-28(48)26(46)23(43)18(13-40)52-32)29(24(44)19(14-41)53-33)54-31-27(47)25(45)22(42)17(12-39)51-31/h17-33,39-48H,1,4-15H2,2-3H3,(H,49,50)/t17-,18-,19-,20?,21?,22-,23-,24-,25+,26+,27-,28-,29+,30-,31+,32+,33+,35+,36+,37+,38-/m0/s1
InChI key:InChIKey=DRSKVOAJKLUMCL-MMUIXFKXSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@](O[C@H]5[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@@H](CO)O5)(C(=C)C4)CC3)CC[C@@]1([C@@](C(O)=O)(C)CCC2)[H])[H]
Synonyms:- (4α)-13-[(O-β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-(1→2)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→3)]-β-<smallcap>D</span>-glucopyranosyl)oxy]kaur-16-en-18-oic acid
- Kaur-16-en-18-oic acid, 13-[(O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→2)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→3)]-β-<smallcap>D</span>-glucopyranosyl)oxy]-, (4α)-
- Rebaudioside B
- Rebaudioside B(P)(New)
- Stevioside a<sub>4</sub>
- Kaur-16-en-18-oic acid, 13-[(O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl)oxy]-, (4α)-
- (4α)-13-[(O-β-D-Glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl)oxy]kaur-16-en-18-oic acid
- Stevioside a4
- (4R)-13-[(2-O-β-D-Glucopyranosyl-3-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]kaur-16-en-18-oic acid
- Rebaudioside B Standard
- REBAUDIOSIDE A(rebiana)(P)
- REBAUDIOSIDE B(SH)
- REBAUDIOSIDEB
- Rebaudioside B (100 mg)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Rebaudioside B, 95%
CAS:Formula:C38H60O18Purity:(HPLC) ≥ 95.0%Color and Shape:White powderMolecular weight:804.87Rebaudioside B
CAS:Rebaudioside BFormula:C38H60O18Purity:≥98%Color and Shape:SolidMolecular weight:804.87Rebaudioside B
CAS:Formula:C38H60O18Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:804.88Rebaudioside B
CAS:Rebaudioside B (REBAUDIOSIDE B(P)(NEW)) tastes about 150 times sweeter than sucrose and it is non-caloric.Formula:C38H60O18Purity:98% - 99.57%Color and Shape:SolidMolecular weight:804.87Ref: TM-T5762
1mg34.00€5mg75.00€1mL*10mM (DMSO)92.00€10mg109.00€25mg198.00€50mg298.00€100mg442.00€200mg628.00€Rebaudioside B
CAS:Natural glycosideFormula:C38H60O18Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:804.89Rebaudioside B
CAS:Rebaudioside B is a type of steviol glycoside, which is a naturally occurring compound extracted from the leaves of the Stevia rebaudiana plant. This plant, native to Paraguay, is known for its intensely sweet leaves, which have been utilized for centuries by indigenous peoples for sweetening purposes.
Formula:C38H60O18Purity:Min. 95%Molecular weight:804.87 g/mol











