CAS 5857-42-1
:Benzenesulfonic acid, 4-methoxy-
Description:
4-Methoxybenzenesulfonic acid, also known as p-methoxybenzenesulfonic acid, is an aromatic sulfonic acid characterized by the presence of a methoxy group (-OCH₃) attached to the benzene ring at the para position relative to the sulfonic acid group (-SO₃H). This compound is typically a white to light yellow solid that is soluble in water and organic solvents, reflecting its polar sulfonic acid functional group. It exhibits acidic properties due to the sulfonic acid moiety, making it a strong acid compared to carboxylic acids. The presence of the methoxy group can influence its reactivity and solubility, often enhancing its nucleophilicity and making it useful in various chemical reactions, including sulfonation and as a reagent in organic synthesis. Additionally, 4-methoxybenzenesulfonic acid can serve as a surfactant or an intermediate in the production of dyes, pharmaceuticals, and other chemical products. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C7H8O4S
InChI:InChI=1S/C7H8O4S/c1-11-6-2-4-7(5-3-6)12(8,9)10/h2-5H,1H3,(H,8,9,10)
InChI key:IWYVYUZADLIDEY-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)S(=O)(=O)O
Synonyms:- 4-Methoxybenzenesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxybenzenesulfonic acid
CAS:Formula:C7H8O4SPurity:98%Color and Shape:SolidMolecular weight:188.20104-Methoxy-benzenesulfonic acid
CAS:4-Methoxy-benzenesulfonic acid
Purity:98%Molecular weight:188.20g/mol4-Methoxybenzenesulfonic acid
CAS:4-Methoxybenzenesulfonic acidFormula:C7H8O4SPurity:98%Molecular weight:188.24-Methoxybenzenesulfonic Acid
CAS:Controlled ProductStability Hygroscopic
Applications 4-Methoxybenzenesulfonic Acid is used as a synthesis of acyl/sulfonyl hydrazine derivatives for pharmaceutical synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Khan, K. et al.: Lett. Org. Chem., 12, 637 (2015); Wen, J. et al.: Synth. Comm., 45, 1574 (2015);Formula:C7H8O4SColor and Shape:NeatMolecular weight:188.24-Methoxybenzenesulfonic acid
CAS:Formula:C7H8O4SPurity:98%Color and Shape:Solid, No data available.Molecular weight:188.2Ref: 10-F434281
Discontinued product




