CAS 58573-94-7
:4-(4'-N-Heptylphenyl)Benzoic Acid
Description:
4-(4'-N-Heptylphenyl)Benzoic Acid, with the CAS number 58573-94-7, is an organic compound characterized by its structure, which features a benzoic acid moiety substituted with a heptyl group attached to a phenyl ring. This compound is typically a solid at room temperature and exhibits properties associated with both hydrophobic and hydrophilic interactions due to the presence of the long aliphatic heptyl chain and the carboxylic acid functional group. It is often utilized in materials science, particularly in the development of liquid crystal displays (LCDs) and other advanced materials, due to its ability to influence the alignment and properties of liquid crystals. The presence of the heptyl group enhances the solubility and thermal stability of the compound, making it suitable for various applications in organic electronics and photonics. Additionally, its molecular structure allows for potential interactions with other chemical species, which can be exploited in various chemical and physical processes.
Formula:C20H24O2
InChI:InChI=1/C20H24O2/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(15-13-18)20(21)22/h8-15H,2-7H2,1H3,(H,21,22)
InChI key:InChIKey=XVROSBHWACAQRL-UHFFFAOYSA-N
SMILES:CCCCCCCc1ccc(cc1)c1ccc(cc1)C(=O)O
Synonyms:- 4'-Heptylbiphenyl-4-Carboxylic Acid
- 4′-Heptyl[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 4′-heptyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(4-Heptylphenyl)benzoic Acid
CAS:Formula:C20H24O2Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:296.414-(4-Heptylphenyl)Benzoic Acid
CAS:4-(4-Heptylphenyl)Benzoic AcidFormula:C20H24O2Purity:95%Molecular weight:296.414-(4-N-HEPTYLPHENYL)BENZOIC ACID
CAS:Formula:C20H24O2Purity:97%Color and Shape:SolidMolecular weight:296.40344-(4-Heptylphenyl)benzoic Acid
CAS:4-(4-Heptylphenyl)benzoic Acid is a polyvinylpyrrolidone (PVP) derivative that has been used experimentally to create nanowires with directional response time. PVP is an amphiphile, which means it has both hydrophilic and hydrophobic properties. The nonionic nature of this polymer makes it suitable for use in aqueous environments. 4-(4-Heptylphenyl)benzoic Acid has been shown to have thermal stability up to 180°C, and when introduced at a high concentration (1 mM), yields of nanowires are high.Formula:C20H24O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:296.4 g/mol




