CymitQuimica logo

CAS 58584-96-6

:

2,6-Difluoro-3-methylpyridine

Description:
2,6-Difluoro-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms at the 2 and 6 positions and a methyl group at the 3 position. This compound has a molecular formula of C6H6F2N and features a nitrogen atom within its aromatic ring, contributing to its basicity and potential reactivity. The presence of fluorine atoms enhances its electronegativity, which can influence its chemical behavior, making it more polar and potentially increasing its reactivity in nucleophilic substitution reactions. 2,6-Difluoro-3-methylpyridine is typically a colorless to pale yellow liquid or solid, depending on the temperature, and has applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in the synthesis of more complex molecules. Its unique structure allows for various interactions, making it a subject of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H5F2N
InChI:InChI=1S/C6H5F2N/c1-4-2-3-5(7)9-6(4)8/h2-3H,1H3
InChI key:InChIKey=DUKUTTINODXDJP-UHFFFAOYSA-N
SMILES:FC1=C(C)C=CC(F)=N1
Synonyms:
  • Pyridine, 2,6-difluoro-3-methyl-
  • 2,6-Difluoro-3-methylpyridine
  • Pyridine, 2,6-difluoro-3-methyl- (9CI)
Found 1 products.