CymitQuimica logo

CAS 58758-45-5

:

3-methoxy-2-(prop-2-yn-1-yloxy)benzaldehyde

Description:
3-Methoxy-2-(prop-2-yn-1-yloxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a methoxy group and an alkyne substituent. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, potentially affecting its reactivity and interaction with other molecules. The alkyne moiety introduces unique properties, such as the ability to participate in cycloaddition reactions or serve as a precursor for further synthetic transformations. This compound may be utilized in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which can be influenced by the substituents present on the benzene ring.
Formula:C11H10O3
InChI:InChI=1/C11H10O3/c1-3-7-14-11-9(8-12)5-4-6-10(11)13-2/h1,4-6,8H,7H2,2H3
SMILES:C#CCOc1c(cccc1OC)C=O
Synonyms:
  • Benzaldehyde, 3-Methoxy-2-(2-Propyn-1-Yloxy)-
Found 1 products.