CAS 58767-51-4
:1H-imidazole-4-sulfonyl chloride
Description:
1H-Imidazole-4-sulfonyl chloride, with the CAS number 58767-51-4, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a sulfonyl chloride functional group, making it a reactive sulfonyl chloride derivative. It is typically a white to off-white solid that is soluble in polar organic solvents. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly for the introduction of sulfonamide groups into various substrates. Additionally, it can serve as a reagent in the preparation of sulfonamides and other biologically active compounds. Due to its reactive nature, it should be handled with care, as it can release hydrochloric acid upon hydrolysis. Overall, 1H-imidazole-4-sulfonyl chloride is valued in medicinal chemistry and materials science for its versatility in functionalization and modification of organic molecules.
Formula:C3H3ClN2O2S
InChI:InChI=1/C3H3ClN2O2S/c4-9(7,8)3-1-5-2-6-3/h1-2H,(H,5,6)
SMILES:c1c([nH]cn1)S(=O)(=O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Imidazole-4-sulfonyl chloride, 97%
CAS:It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. ThFormula:C3H3ClN2O2SPurity:97%Molecular weight:165.961H-Imidazole-4-sulfonyl chloride
CAS:Formula:C3H3ClN2O2SPurity:95%Color and Shape:SolidMolecular weight:166.58611H-imidazole-4-sulfonyl chloride
CAS:1H-imidazole-4-sulfonyl chloride
Purity:98%Color and Shape:SolidMolecular weight:166.59g/mol1H-IMIDAZOLE-4-SULFONYL CHLORIDE
CAS:Formula:C3H3ClN2O2SPurity:95%Color and Shape:SolidMolecular weight:166.58



