CymitQuimica logo

CAS 58767-51-4

:

1H-imidazole-4-sulfonyl chloride

Description:
1H-Imidazole-4-sulfonyl chloride, with the CAS number 58767-51-4, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a sulfonyl chloride functional group, making it a reactive sulfonyl chloride derivative. It is typically a white to off-white solid that is soluble in polar organic solvents. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly for the introduction of sulfonamide groups into various substrates. Additionally, it can serve as a reagent in the preparation of sulfonamides and other biologically active compounds. Due to its reactive nature, it should be handled with care, as it can release hydrochloric acid upon hydrolysis. Overall, 1H-imidazole-4-sulfonyl chloride is valued in medicinal chemistry and materials science for its versatility in functionalization and modification of organic molecules.
Formula:C3H3ClN2O2S
InChI:InChI=1/C3H3ClN2O2S/c4-9(7,8)3-1-5-2-6-3/h1-2H,(H,5,6)
InChI key:MXCZCMCHRWGSBX-UHFFFAOYSA-N
SMILES:c1c([nH]cn1)S(=O)(=O)Cl
Found 5 products.