CymitQuimica logo

CAS 588720-14-3

:

7-chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid

Description:
7-Chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a chlorine atom at the 7-position of the pyrrolo ring contributes to its reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound is of interest in medicinal chemistry due to its potential as a scaffold for drug development, particularly in targeting specific biological pathways. Its structural features may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Additionally, the compound's ability to form hydrogen bonds and engage in π-π stacking interactions may play a role in its interactions with biological macromolecules. Overall, 7-chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid represents a versatile building block for further chemical modifications and applications in pharmaceutical research.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-7-2-1-5-3-6(8(12)13)10-4-11(5)7/h1-4H,(H,12,13)
SMILES:c1cc(Cl)n2cnc(cc12)C(=O)O.Cl
Synonyms:
  • 7-Chloropyrrolo[1,2-c]pyrimidine-3-carboxylic acid
  • pyrrolo[1,2-c]pyrimidine-3-carboxylic acid, 7-chloro-
Found 1 products.