CymitQuimica logo

CAS 58899-27-7

:

Butanoic acid, 4-[(1,2,3,4-tetrahydro-2-oxo-7-quinolinyl)oxy]-

Description:
Butanoic acid, 4-[(1,2,3,4-tetrahydro-2-oxo-7-quinolinyl)oxy]- is a chemical compound characterized by its butanoic acid backbone, which is a four-carbon carboxylic acid known for its distinctive odor and presence in various biological systems. The compound features a quinoline derivative, specifically a tetrahydro-2-oxo-7-quinolinyl moiety, which contributes to its potential biological activity and pharmacological properties. The presence of the ether linkage (the -O- group connecting the butanoic acid and the quinoline structure) suggests that this compound may exhibit unique solubility and reactivity characteristics. Butanoic acid derivatives are often studied for their roles in medicinal chemistry, as they can influence the bioactivity of the molecule. The CAS number 58899-27-7 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, this compound may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c15-12-6-4-9-3-5-10(8-11(9)14-12)18-7-1-2-13(16)17/h3,5,8H,1-2,4,6-7H2,(H,14,15)(H,16,17)
InChI key:JLLAHJYNQOJXOM-UHFFFAOYSA-N
SMILES:C1CC(=O)NC2=C1C=CC(=C2)OCCCC(=O)O
Found 12 products.