CAS 58910-96-6

1,3,6,8-tetrachloro-9H-carbazole

Description:

1,3,6,8-Tetrachloro-9H-carbazole is an organic compound characterized by its complex structure, which includes a carbazole core substituted with four chlorine atoms at the 1, 3, 6, and 8 positions. This compound is typically a solid at room temperature and exhibits a dark color due to the presence of multiple chlorinated aromatic rings. It is known for its stability and resistance to degradation, making it useful in various applications, including as a dye or pigment. The chlorination enhances its electronic properties, which can be beneficial in electronic and photonic applications. Additionally, 1,3,6,8-tetrachloro-9H-carbazole may exhibit interesting photophysical properties, such as fluorescence, depending on its environment. However, due to the presence of chlorine atoms, it may also pose environmental and health risks, necessitating careful handling and disposal. Overall, this compound is of interest in both industrial and research settings, particularly in the fields of materials science and organic chemistry.

Formula: C₁₂H₅Cl₄N

InChI: InChI=1/C12H5Cl4N/c13-5-1-7-8-2-6(14)4-10(16)12(8)17-11(7)9(15)3-5/h1-4,17H

SMILES: c1c(cc(c2c1c1cc(cc(c1[nH]2)Cl)Cl)Cl)Cl

Synonyms:

• 9H-Carbazole, 1,3,6,8-tetrachloro-

1,3,6,8-Tetrachloro-9H-carbazole

Controlled Product

CAS: 58910-96-6

Formula: C₁₂H₅Cl₄N

Color and Shape: Neat

Molecular weight: 304.987

Ref: TR-T798270