CAS 58919-61-2
:Coprine
Description:
Coprine, with the CAS number 58919-61-2, is a chemical compound primarily known for its association with certain mushroom species, particularly those in the Coprinus genus. It is classified as a cyclic amine and is notable for its potential effects on human health, particularly when consumed in conjunction with alcohol. Coprine acts as an inhibitor of the enzyme acetaldehyde dehydrogenase, leading to the accumulation of acetaldehyde in the body, which can cause unpleasant reactions similar to those experienced with disulfiram (Antabuse). This reaction can include symptoms such as flushing, nausea, and palpitations, making coprine a subject of interest in both toxicology and pharmacology. In addition to its effects on humans, coprine has been studied for its potential ecological roles and interactions within its natural habitat. Its chemical structure and properties contribute to its biological activity, making it a compound of interest in both mycology and medicinal chemistry.
Formula:C8H14N2O4
InChI:InChI=1S/C8H14N2O4/c9-5(7(12)13)1-2-6(11)10-8(14)3-4-8/h5,14H,1-4,9H2,(H,10,11)(H,12,13)/t5-/m0/s1
InChI key:InChIKey=OEEZRBUCLFMTLD-YFKPBYRVSA-N
SMILES:N(C(CC[C@@H](C(O)=O)N)=O)C1(O)CC1
Synonyms:- (2S)-2-Amino-4-[(1-hydroxycyclopropyl)carbamoyl]butanoic acid
- (S)-2-Amino-5-((1-hydroxycyclopropyl)amino)-5-oxopentanoic acid
- 58919-61-2
- <span class="text-smallcaps">L</span>-Glutamine, N-(1-hydroxycyclopropyl)-
- Coprine
- N-(1-Hydroxycyclopropyl)-<span class="text-smallcaps">L</span>-glutamine
- L-Glutamine, N-(1-hydroxycyclopropyl)-
- N-(1-Hydroxycyclopropyl)-L-glutamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Coprine
CAS:Coprine is a poisonous toxin that exists in mushrooms resulting in coprinus syndrome.Formula:C8H14N2O4Color and Shape:SolidMolecular weight:202.21

