CAS 5893-05-0
:N-tritylglycine
Description:
N-tritylglycine, with the CAS number 5893-05-0, is an amino acid derivative characterized by the presence of a trityl group (a triphenylmethyl group) attached to the nitrogen of glycine. This modification enhances its stability and solubility in organic solvents, making it useful in various chemical applications, including peptide synthesis and as a protecting group in organic chemistry. N-tritylglycine typically appears as a white to off-white crystalline solid and is relatively stable under standard laboratory conditions. Its molecular structure includes a central glycine backbone, which consists of an amino group, a carboxyl group, and a side chain that is simply a hydrogen atom, while the trityl group significantly increases its steric bulk. This compound is often utilized in the synthesis of more complex molecules due to its ability to protect the amino group during reactions. Additionally, N-tritylglycine can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C34H42N4O5
InChI:InChI=1/C34H42N4O5/c1-3-4-21-42-27-14-11-25(12-15-27)33(39)36-26-13-16-30(29(23-26)34(40)35-24-28-8-7-22-43-28)37-17-19-38(20-18-37)31-9-5-6-10-32(31)41-2/h5-6,9-16,23,28H,3-4,7-8,17-22,24H2,1-2H3,(H,35,40)(H,36,39)
SMILES:CCCCOc1ccc(cc1)C(=O)Nc1ccc(c(c1)C(=NCC1CCCO1)O)N1CCN(CC1)c1ccccc1OC
Synonyms:- N-Tritylglycine~Trt-Gly-OH
- Trt-Gly-OH
- 5-{[(4-butoxyphenyl)carbonyl]amino}-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(tetrahydrofuran-2-ylmethyl)benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Trt-Gly-OH
CAS:Bachem ID: 4014956.
Formula:C21H19NO2Color and Shape:Yellowish PowderMolecular weight:317.39N-(Triphenylmethyl)glycine
CAS:Formula:C21H19NO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:317.39N-Tritylglycine
CAS:N-Tritylglycine is an acidic amino acid that can be protonated in a highly acidic environment. It has been shown to inhibit the growth of tumor tissue by inducing apoptosis and inhibiting protein synthesis. N-Tritylglycine is used as a reagent for analytical chemistry, where it is used to detect amines such as histamine and serotonin. N-Tritylglycine also has been shown to be potent inhibitor of kinesin.
Formula:C21H19NO2Purity:Min. 95%Molecular weight:317.38 g/mol







