CAS 59-82-5
:5-Nitro-2-furonitrile
Description:
5-Nitro-2-furonitrile, with the CAS number 59-82-5, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a nitro group (-NO2) and a nitrile group (-C≡N) attached to the furan ring, contributing to its reactivity and chemical properties. It is typically a yellow to brown solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both the nitro and nitrile functional groups makes it a versatile compound in chemical reactions, including nucleophilic substitutions and reductions. Additionally, 5-Nitro-2-furonitrile may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water.
Formula:C5H2N2O3
InChI:InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H
SMILES:c1cc(N(=O)=O)oc1C#N
Synonyms:- 5-Nitro-2-furancarbonitrile
- 5-Nitrofuran-2-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Nitro-2-furonitrile, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H2N2O3Purity:97%Color and Shape:Pale yellow to yellow to pale brown to cream, Crystals or powder or crystalline powderMolecular weight:138.085-Nitro-2-furonitrile
CAS:5-Nitro-2-furonitrileFormula:C5H2N2O3Purity:97%Color and Shape:Yellow Solid-PowderMolecular weight:138.080975-Nitrofuran-2-carbonitrile
CAS:5-Nitrofuran-2-carbonitrileFormula:C5H2N2O3Purity:95%Molecular weight:138.085-Nitro-2-furonitrile
CAS:5-Nitro-2-furonitrile is a nitro compound that is used in the synthesis of other organic compounds. 5-Nitro-2-furonitrile reacts with chloride ions, hydrogen chloride and acid to form nitro radicals, which have a kinetic energy of 5 kcal/mole. The resulting nitro radical can then react with an olefinic or alkoxy radical to form 3-chloroperoxybenzoic acid. This reaction releases the chloride ion and generates hydrochloric acid. 5-Nitro-2-furonitrile is also capable of reacting with azides such as phosphorus oxychloride, forming an azide radical that can be oxidized by 3-chloroperoxybenzoic acid to form a nitric oxide radical. Nitric oxide radicals react with oxygen molecules to produce ozone, thereby releasing the chloride ion and generating hydrochloric acid. 5-Nitro-2-furonitrile is usedFormula:C5H2N2O3Purity:Min. 95%Molecular weight:138.08 g/molRef: 10-F942859
Discontinued product





